C26H34N4O4 — CID 45176946
1-butan-2-yl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 45176946) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-butan-2-yl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 1-butan-2-yl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 45176946 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-butan-2-yl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1cn(C(C)CC)cc(C(=O)N2CCN(Cc3ccccc3OC)CC2)c1=O |
| InChI | InChI=1S/C26H34N4O4/c1-5-11-27-25(32)21-17-30(19(3)6-2)18-22(24(21)31)26(33)29-14-12-28(13-15-29)16-20-9-7-8-10-23(20)34-4/h5,7-10,17-19H,1,6,11-16H2,2-4H3,(H,27,32) |
| InChIKey | JEOIARANUHAQTL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|