C27H34N4O3 — CID 26334451
1-cyclopentyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 26334451) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-cyclopentyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 1-cyclopentyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 26334451 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-cyclopentyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1cn(C2CCCC2)cc(C(=O)N2CCN(Cc3cccc(C)c3)CC2)c1=O |
| InChI | InChI=1S/C27H34N4O3/c1-3-11-28-26(33)23-18-31(22-9-4-5-10-22)19-24(25(23)32)27(34)30-14-12-29(13-15-30)17-21-8-6-7-20(2)16-21/h3,6-8,16,18-19,22H,1,4-5,9-15,17H2,2H3,(H,28,33) |
| InChIKey | WSCKBIXFZHMJFU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|