About 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide
1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide (PubChem CID 42420972) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide |
| PubChem CID | 42420972 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cn([C@@H](C)CC)cc(C(=O)NCCCC)c1=O |
| InChI | InChI=1S/C18H27N3O3/c1-5-8-10-20-18(24)15-12-21(13(4)7-3)11-14(16(15)22)17(23)19-9-6-2/h6,11-13H,2,5,7-10H2,1,3-4H3,(H,19,23)(H,20,24)/t13-/m0/s1 |
| InChIKey | IVBRYHWDDFVLKE-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide?
The IUPAC name of 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide (CID 42420972) is 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide.
What is the SMILES notation for 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide?
The canonical SMILES for 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide is C=CCNC(=O)c1cn([C@@H](C)CC)cc(C(=O)NCCCC)c1=O.
What is the InChIKey of 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide?
The InChIKey is IVBRYHWDDFVLKE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-5-8-10-20-18(24)15-12-21(13(4)7-3)11-14(16(15)22)17(23)19-9-6-2/h6,11-13H,2,5,7-10H2,1,3-4H3,(H,19,23)(H,20,24)/t13-/m0/s1.
What are the key properties of 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide?
1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide has a molecular weight of 333.43 g/mol, XLogP of 2.27, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-butan-2-yl]-5-N-butyl-4-oxo-3-N-prop-2-enylpyridine-3,5-dicarboxamide is sourced from PubChem (CID 42420972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).