C22H29N3O4 — CID 45243150
1-butan-2-yl-3-N-ethyl-5-N-(furan-2-ylmethyl)-3-N-(2-methylprop-2-enyl)-4-oxopyridine-3,5-dicarboxamide (PubChem CID 45243150) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-butan-2-yl-3-N-ethyl-5-N-(furan-2-ylmethyl)-3-N-(2-methylprop-2-enyl)-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-butan-2-yl-3-N-ethyl-5-N-(furan-2-ylmethyl)-3-N-(2-methylprop-2-enyl)-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45243150 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-butan-2-yl-3-N-ethyl-5-N-(furan-2-ylmethyl)-3-N-(2-methylprop-2-enyl)-4-oxopyridine-3,5-dicarboxamide |
| SMILES | C=C(C)CN(CC)C(=O)c1cn(C(C)CC)cc(C(=O)NCc2ccco2)c1=O |
| InChI | InChI=1S/C22H29N3O4/c1-6-16(5)25-13-18(21(27)23-11-17-9-8-10-29-17)20(26)19(14-25)22(28)24(7-2)12-15(3)4/h8-10,13-14,16H,3,6-7,11-12H2,1-2,4-5H3,(H,23,27) |
| InChIKey | XEGROBBDNLUGEO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|