C19H20BrNO2 — CID 26367142
5-bromo-3-[(3,4-diethoxyphenyl)methyl]-1H-indole (PubChem CID 26367142) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 5-bromo-3-[(3,4-diethoxyphenyl)methyl]-1H-indole.
| Compound Name | 5-bromo-3-[(3,4-diethoxyphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 26367142 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 5-bromo-3-[(3,4-diethoxyphenyl)methyl]-1H-indole |
| SMILES | CCOc1ccc(Cc2c[nH]c3ccc(Br)cc23)cc1OCC |
| InChI | InChI=1S/C19H20BrNO2/c1-3-22-18-8-5-13(10-19(18)23-4-2)9-14-12-21-17-7-6-15(20)11-16(14)17/h5-8,10-12,21H,3-4,9H2,1-2H3 |
| InChIKey | PLOQSXFQAVIYNN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |