C18H18ClNO5 — CID 2637238
methyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-methoxybenzoate (PubChem CID 2637238) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is methyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-methoxybenzoate.
| Compound Name | methyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 2637238 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | methyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2ccc(C)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C18H18ClNO5/c1-11-4-6-13(9-14(11)19)20-17(21)10-25-15-7-5-12(18(22)24-3)8-16(15)23-2/h4-9H,10H2,1-3H3,(H,20,21) |
| InChIKey | USFLPUSDXAIBGQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |