About cobalt(2+) disulfamate
cobalt(2+) disulfamate (PubChem CID 26398) has the molecular formula H4CoN2O6S2
and a molecular weight of 251.11 g/mol. Its IUPAC name is cobalt(2+) disulfamate.
Molecular Properties
| Compound Name | cobalt(2+) disulfamate |
| PubChem CID | 26398 |
| Molecular Formula | H4CoN2O6S2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.88 |
| IUPAC Name | cobalt(2+) disulfamate |
| SMILES | NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2] |
| InChI | InChI=1S/Co.2H3NO3S/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | WLQXLCXXAPYDIU-UHFFFAOYSA-L |
| XLogP | -3.19 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+) disulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+) disulfamate?
The IUPAC name of cobalt(2+) disulfamate (CID 26398) is cobalt(2+) disulfamate.
What is the SMILES notation for cobalt(2+) disulfamate?
The canonical SMILES for cobalt(2+) disulfamate is NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2].
What is the InChIKey of cobalt(2+) disulfamate?
The InChIKey is WLQXLCXXAPYDIU-UHFFFAOYSA-L. The full InChI is InChI=1S/Co.2H3NO3S/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2.
What are the key properties of cobalt(2+) disulfamate?
cobalt(2+) disulfamate has a molecular weight of 251.11 g/mol, XLogP of -3.19, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+) disulfamate is sourced from PubChem (CID 26398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).