About azanide;nickel(2+);sulfamate
azanide;nickel(2+);sulfamate (PubChem CID 174833481) has the molecular formula H4N2NiO3S
and a molecular weight of 170.80 g/mol. Its IUPAC name is azanide;nickel(2+);sulfamate.
Molecular Properties
| Compound Name | azanide;nickel(2+);sulfamate |
| PubChem CID | 174833481 |
| Molecular Formula | H4N2NiO3S |
| Molecular Weight | 170.80 g/mol |
| Exact Mass | 169.93 |
| IUPAC Name | azanide;nickel(2+);sulfamate |
| SMILES | NS(=O)(=O)[O-].[NH2-].[Ni+2] |
| InChI | InChI=1S/H3NO3S.H2N.Ni/c1-5(2,3)4;;/h(H3,1,2,3,4);1H2;/q;-1;+2/p-1 |
| InChIKey | VVLDUVHMMSYJKI-UHFFFAOYSA-M |
| XLogP | -0.88 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.80 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanide;nickel(2+);sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;nickel(2+);sulfamate?
The IUPAC name of azanide;nickel(2+);sulfamate (CID 174833481) is azanide;nickel(2+);sulfamate.
What is the SMILES notation for azanide;nickel(2+);sulfamate?
The canonical SMILES for azanide;nickel(2+);sulfamate is NS(=O)(=O)[O-].[NH2-].[Ni+2].
What is the InChIKey of azanide;nickel(2+);sulfamate?
The InChIKey is VVLDUVHMMSYJKI-UHFFFAOYSA-M. The full InChI is InChI=1S/H3NO3S.H2N.Ni/c1-5(2,3)4;;/h(H3,1,2,3,4);1H2;/q;-1;+2/p-1.
What are the key properties of azanide;nickel(2+);sulfamate?
azanide;nickel(2+);sulfamate has a molecular weight of 170.80 g/mol, XLogP of -0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;nickel(2+);sulfamate is sourced from PubChem (CID 174833481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).