About oxepine sulfamate
oxepine sulfamate (PubChem CID 22347807) has the molecular formula C6H8NO4S-
and a molecular weight of 190.20 g/mol. Its IUPAC name is oxepine sulfamate.
Molecular Properties
| Compound Name | oxepine sulfamate |
| PubChem CID | 22347807 |
| Molecular Formula | C6H8NO4S- |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | oxepine sulfamate |
| SMILES | C1=CC=COC=C1.NS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H6O.H3NO3S/c1-2-4-6-7-5-3-1;1-5(2,3)4/h1-6H;(H3,1,2,3,4)/p-1 |
| InChIKey | UBMGPCVQLGUQDM-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze oxepine sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxepine sulfamate?
The IUPAC name of oxepine sulfamate (CID 22347807) is oxepine sulfamate.
What is the SMILES notation for oxepine sulfamate?
The canonical SMILES for oxepine sulfamate is C1=CC=COC=C1.NS(=O)(=O)[O-].
What is the InChIKey of oxepine sulfamate?
The InChIKey is UBMGPCVQLGUQDM-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O.H3NO3S/c1-2-4-6-7-5-3-1;1-5(2,3)4/h1-6H;(H3,1,2,3,4)/p-1.
What are the key properties of oxepine sulfamate?
oxepine sulfamate has a molecular weight of 190.20 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxepine sulfamate is sourced from PubChem (CID 22347807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).