About nickel(2+);cyanide;sulfamate
nickel(2+);cyanide;sulfamate (PubChem CID 160755995) has the molecular formula CH2N2NiO3S
and a molecular weight of 180.80 g/mol. Its IUPAC name is nickel(2+);cyanide;sulfamate.
Molecular Properties
| Compound Name | nickel(2+);cyanide;sulfamate |
| PubChem CID | 160755995 |
| Molecular Formula | CH2N2NiO3S |
| Molecular Weight | 180.80 g/mol |
| Exact Mass | 179.91 |
| IUPAC Name | nickel(2+);cyanide;sulfamate |
| SMILES | NS(=O)(=O)[O-].[C-]#N.[Ni+2] |
| InChI | InChI=1S/CN.H3NO3S.Ni/c1-2;1-5(2,3)4;/h;(H3,1,2,3,4);/q-1;;+2/p-1 |
| InChIKey | RXLBRZDFEUSVLS-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.80 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);cyanide;sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);cyanide;sulfamate?
The IUPAC name of nickel(2+);cyanide;sulfamate (CID 160755995) is nickel(2+);cyanide;sulfamate.
What is the SMILES notation for nickel(2+);cyanide;sulfamate?
The canonical SMILES for nickel(2+);cyanide;sulfamate is NS(=O)(=O)[O-].[C-]#N.[Ni+2].
What is the InChIKey of nickel(2+);cyanide;sulfamate?
The InChIKey is RXLBRZDFEUSVLS-UHFFFAOYSA-M. The full InChI is InChI=1S/CN.H3NO3S.Ni/c1-2;1-5(2,3)4;/h;(H3,1,2,3,4);/q-1;;+2/p-1.
What are the key properties of nickel(2+);cyanide;sulfamate?
nickel(2+);cyanide;sulfamate has a molecular weight of 180.80 g/mol, XLogP of -1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);cyanide;sulfamate is sourced from PubChem (CID 160755995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).