C29H33N3O3 — CID 26403133
1-benzyl-5-N-ethyl-4-oxo-3-N-[(1-phenylcyclohexyl)methyl]pyridine-3,5-dicarboxamide (PubChem CID 26403133) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-benzyl-5-N-ethyl-4-oxo-3-N-[(1-phenylcyclohexyl)methyl]pyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-5-N-ethyl-4-oxo-3-N-[(1-phenylcyclohexyl)methyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 26403133 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-benzyl-5-N-ethyl-4-oxo-3-N-[(1-phenylcyclohexyl)methyl]pyridine-3,5-dicarboxamide |
| SMILES | CCNC(=O)c1cn(Cc2ccccc2)cc(C(=O)NCC2(c3ccccc3)CCCCC2)c1=O |
| InChI | InChI=1S/C29H33N3O3/c1-2-30-27(34)24-19-32(18-22-12-6-3-7-13-22)20-25(26(24)33)28(35)31-21-29(16-10-5-11-17-29)23-14-8-4-9-15-23/h3-4,6-9,12-15,19-20H,2,5,10-11,16-18,21H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | OTLALYCSEFYLSK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |