C26H30N4O3 — CID 26410179
3-[(3,4-dimethoxyphenyl)methyl]-5-[[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,2,4-oxadiazole (PubChem CID 26410179) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-[[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26410179 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(Cc2noc(CN3CCc4c([nH]c5ccccc45)[C@@H]3C(C)C)n2)cc1OC |
| InChI | InChI=1S/C26H30N4O3/c1-16(2)26-25-19(18-7-5-6-8-20(18)27-25)11-12-30(26)15-24-28-23(29-33-24)14-17-9-10-21(31-3)22(13-17)32-4/h5-10,13,16,26-27H,11-12,14-15H2,1-4H3/t26-/m0/s1 |
| InChIKey | BHLZXLNWXQGEAU-SANMLTNESA-N |
| XLogP | 4.91 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|