C24H23N3O3 — CID 26419995
7-[4-(naphthalen-1-ylmethyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 26419995) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-[4-(naphthalen-1-ylmethyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(naphthalen-1-ylmethyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 26419995 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 7-[4-(naphthalen-1-ylmethyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)N3CCN(Cc4cccc5ccccc45)CC3)ccc2N1 |
| InChI | InChI=1S/C24H23N3O3/c28-23-16-30-22-14-18(8-9-21(22)25-23)24(29)27-12-10-26(11-13-27)15-19-6-3-5-17-4-1-2-7-20(17)19/h1-9,14H,10-13,15-16H2,(H,25,28) |
| InChIKey | BXKYXFPDSHQPLS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |