C26H19N3O5S — CID 2642299
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 2642299) has the molecular formula C26H19N3O5S and a molecular weight of 485.52 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2642299 |
| Molecular Formula | C26H19N3O5S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | O=C1COc2ccc(C(=O)COC(=O)/C=C/c3cn(-c4ccccc4)nc3-c3cccs3)cc2N1 |
| InChI | InChI=1S/C26H19N3O5S/c30-21(17-8-10-22-20(13-17)27-24(31)16-33-22)15-34-25(32)11-9-18-14-29(19-5-2-1-3-6-19)28-26(18)23-7-4-12-35-23/h1-14H,15-16H2,(H,27,31)/b11-9+ |
| InChIKey | NDZFJIDYUMIKRX-PKNBQFBNSA-N |
| XLogP | 4.37 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|