C22H23N3O4 — CID 26433355
(4S,5R,6R)-6-hydroxy-4-(4-hydroxyphenyl)-6-methyl-N-(2-methylphenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxamide (PubChem CID 26433355) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (4S,5R,6R)-6-hydroxy-4-(4-hydroxyphenyl)-6-methyl-N-(2-methylphenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxamide.
| Compound Name | (4S,5R,6R)-6-hydroxy-4-(4-hydroxyphenyl)-6-methyl-N-(2-methylphenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 26433355 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (4S,5R,6R)-6-hydroxy-4-(4-hydroxyphenyl)-6-methyl-N-(2-methylphenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@@H]1[C@@H](c2ccc(O)cc2)c2c([nH][nH]c2=O)C[C@@]1(C)O |
| InChI | InChI=1S/C22H23N3O4/c1-12-5-3-4-6-15(12)23-21(28)19-17(13-7-9-14(26)10-8-13)18-16(11-22(19,2)29)24-25-20(18)27/h3-10,17,19,26,29H,11H2,1-2H3,(H,23,28)(H2,24,25,27)/t17-,19-,22+/m0/s1 |
| InChIKey | HTMIVWKRALTAAE-LQBOVUBWSA-N |
| XLogP | 2.41 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |