C22H27NO3S — CID 26433526
(4S,7R)-7-tert-butyl-4-(3-hydroxy-4-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one (PubChem CID 26433526) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (4S,7R)-7-tert-butyl-4-(3-hydroxy-4-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one.
| Compound Name | (4S,7R)-7-tert-butyl-4-(3-hydroxy-4-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 26433526 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (4S,7R)-7-tert-butyl-4-(3-hydroxy-4-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
| SMILES | COc1ccc([C@@H]2CC(=O)Nc3sc4c(c32)CC[C@@H](C(C)(C)C)C4)cc1O |
| InChI | InChI=1S/C22H27NO3S/c1-22(2,3)13-6-7-14-18(10-13)27-21-20(14)15(11-19(25)23-21)12-5-8-17(26-4)16(24)9-12/h5,8-9,13,15,24H,6-7,10-11H2,1-4H3,(H,23,25)/t13-,15+/m1/s1 |
| InChIKey | YFPWRQWYFJODAC-HIFRSBDPSA-N |
| XLogP | 5.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |