C17H17NO2S — CID 26415902
(4S)-4-(4-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one (PubChem CID 26415902) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is (4S)-4-(4-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one.
| Compound Name | (4S)-4-(4-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 26415902 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (4S)-4-(4-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C17H17NO2S/c19-11-7-5-10(6-8-11)13-9-15(20)18-17-16(13)12-3-1-2-4-14(12)21-17/h5-8,13,19H,1-4,9H2,(H,18,20)/t13-/m0/s1 |
| InChIKey | DUXPKSBEKAWFLQ-ZDUSSCGKSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |