C17H16FNOS — CID 16766706
4-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one (PubChem CID 16766706) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one.
| Compound Name | 4-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 16766706 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
| SMILES | O=C1CC(c2ccc(F)cc2)c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C17H16FNOS/c18-11-7-5-10(6-8-11)13-9-15(20)19-17-16(13)12-3-1-2-4-14(12)21-17/h5-8,13H,1-4,9H2,(H,19,20) |
| InChIKey | IHTRIJPISMAVBF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |