C16H18ClN3O5S — CID 2646960
2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 2646960) has the molecular formula C16H18ClN3O5S and a molecular weight of 399.86 g/mol. Its IUPAC name is 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 2646960 |
| Molecular Formula | C16H18ClN3O5S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | C[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)N[C@@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C16H18ClN3O5S/c1-16(10-2-4-11(17)5-3-10)14(22)20(15(23)19-16)8-13(21)18-12-6-7-26(24,25)9-12/h2-5,12H,6-9H2,1H3,(H,18,21)(H,19,23)/t12-,16-/m1/s1 |
| InChIKey | QYHCDYHVZPTIJY-MLGOLLRUSA-N |
| XLogP | 0.41 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|