C16H12Cl2N2O4S — CID 13312643
5-[5-chloro-2-[(4-chlorophenyl)methylsulfonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 13312643) has the molecular formula C16H12Cl2N2O4S and a molecular weight of 399.26 g/mol. Its IUPAC name is 5-[5-chloro-2-[(4-chlorophenyl)methylsulfonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[5-chloro-2-[(4-chlorophenyl)methylsulfonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 13312643 |
| Molecular Formula | C16H12Cl2N2O4S |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 5-[5-chloro-2-[(4-chlorophenyl)methylsulfonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cc(Cl)ccc2S(=O)(=O)Cc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C16H12Cl2N2O4S/c17-10-3-1-9(2-4-10)8-25(23,24)13-6-5-11(18)7-12(13)14-15(21)20-16(22)19-14/h1-7,14H,8H2,(H2,19,20,21,22) |
| InChIKey | JBFCCKVDWQPSBY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|