C10H8Cl2N2O4S — CID 13312645
5-(3,5-dichloro-2-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 13312645) has the molecular formula C10H8Cl2N2O4S and a molecular weight of 323.16 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(3,5-dichloro-2-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 13312645 |
| Molecular Formula | C10H8Cl2N2O4S |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-(3,5-dichloro-2-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)c1c(Cl)cc(Cl)cc1C1NC(=O)NC1=O |
| InChI | InChI=1S/C10H8Cl2N2O4S/c1-19(17,18)8-5(2-4(11)3-6(8)12)7-9(15)14-10(16)13-7/h2-3,7H,1H3,(H2,13,14,15,16) |
| InChIKey | JTOZBIIWPYRCRY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|