C9H8ClN3O4S — CID 13312649
4-chloro-2-(2,5-dioxoimidazolidin-4-yl)benzenesulfonamide (PubChem CID 13312649) has the molecular formula C9H8ClN3O4S and a molecular weight of 289.70 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dioxoimidazolidin-4-yl)benzenesulfonamide.
| Compound Name | 4-chloro-2-(2,5-dioxoimidazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 13312649 |
| Molecular Formula | C9H8ClN3O4S |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 4-chloro-2-(2,5-dioxoimidazolidin-4-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)cc1C1NC(=O)NC1=O |
| InChI | InChI=1S/C9H8ClN3O4S/c10-4-1-2-6(18(11,16)17)5(3-4)7-8(14)13-9(15)12-7/h1-3,7H,(H2,11,16,17)(H2,12,13,14,15) |
| InChIKey | XYIUNVBJJDHGAH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|