C16H12Cl2N2O3S — CID 13312634
5-[5-chloro-2-[(4-chlorophenyl)methylsulfinyl]phenyl]imidazolidine-2,4-dione (PubChem CID 13312634) has the molecular formula C16H12Cl2N2O3S and a molecular weight of 383.26 g/mol. Its IUPAC name is 5-[5-chloro-2-[(4-chlorophenyl)methylsulfinyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[5-chloro-2-[(4-chlorophenyl)methylsulfinyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 13312634 |
| Molecular Formula | C16H12Cl2N2O3S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 5-[5-chloro-2-[(4-chlorophenyl)methylsulfinyl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cc(Cl)ccc2S(=O)Cc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C16H12Cl2N2O3S/c17-10-3-1-9(2-4-10)8-24(23)13-6-5-11(18)7-12(13)14-15(21)20-16(22)19-14/h1-7,14H,8H2,(H2,19,20,21,22) |
| InChIKey | ABOWUFCCIBSPCV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|