C18H17FN2 — CID 26477346
(5S,6R)-6-(4-fluorophenyl)-2,2-dimethyl-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 26477346) has the molecular formula C18H17FN2 and a molecular weight of 280.35 g/mol. Its IUPAC name is (5S,6R)-6-(4-fluorophenyl)-2,2-dimethyl-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (5S,6R)-6-(4-fluorophenyl)-2,2-dimethyl-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 26477346 |
| Molecular Formula | C18H17FN2 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (5S,6R)-6-(4-fluorophenyl)-2,2-dimethyl-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | CC1(C)N=C(c2ccccc2)[C@@H]2[C@@H](c3ccc(F)cc3)N21 |
| InChI | InChI=1S/C18H17FN2/c1-18(2)20-15(12-6-4-3-5-7-12)17-16(21(17)18)13-8-10-14(19)11-9-13/h3-11,16-17H,1-2H3/t16-,17-,21?/m1/s1 |
| InChIKey | FKXQXRQPEFDXGX-LJMNQJIDSA-N |
| XLogP | 3.79 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|