C18H14F6N2 — CID 138964699
3-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-2,4-dihydroimidazole (PubChem CID 138964699) has the molecular formula C18H14F6N2 and a molecular weight of 372.31 g/mol. Its IUPAC name is 3-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-2,4-dihydroimidazole.
| Compound Name | 3-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 138964699 |
| Molecular Formula | C18H14F6N2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-2,4-dihydroimidazole |
| SMILES | FC(F)(F)c1cc(C2=NCN(Cc3ccccc3)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2/c19-17(20,21)14-6-13(7-15(8-14)18(22,23)24)16-10-26(11-25-16)9-12-4-2-1-3-5-12/h1-8H,9-11H2 |
| InChIKey | PBRQZFIYMDYCRO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |