C23H25F2N3 — CID 54275909
1-benzyl-4-[4-benzyl-2-(difluoromethyl)imidazol-2-yl]piperidine (PubChem CID 54275909) has the molecular formula C23H25F2N3 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-benzyl-4-[4-benzyl-2-(difluoromethyl)imidazol-2-yl]piperidine.
| Compound Name | 1-benzyl-4-[4-benzyl-2-(difluoromethyl)imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 54275909 |
| Molecular Formula | C23H25F2N3 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-benzyl-4-[4-benzyl-2-(difluoromethyl)imidazol-2-yl]piperidine |
| SMILES | FC(F)C1(C2CCN(Cc3ccccc3)CC2)N=CC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C23H25F2N3/c24-22(25)23(26-16-21(27-23)15-18-7-3-1-4-8-18)20-11-13-28(14-12-20)17-19-9-5-2-6-10-19/h1-10,16,20,22H,11-15,17H2 |
| InChIKey | RNKBVXVGKMRMQP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |