C16H11F5N2 — CID 138964698
3-benzyl-5-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydroimidazole (PubChem CID 138964698) has the molecular formula C16H11F5N2 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-benzyl-5-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydroimidazole.
| Compound Name | 3-benzyl-5-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 138964698 |
| Molecular Formula | C16H11F5N2 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-benzyl-5-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydroimidazole |
| SMILES | Fc1c(F)c(F)c(C2=NCN(Cc3ccccc3)C2)c(F)c1F |
| InChI | InChI=1S/C16H11F5N2/c17-12-11(13(18)15(20)16(21)14(12)19)10-7-23(8-22-10)6-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | YKPFVLBTJLJUNT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|