C14H13F3N2 — CID 91446839
2-phenyl-6-(trifluoromethyl)-3,5,8,8a-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 91446839) has the molecular formula C14H13F3N2 and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-phenyl-6-(trifluoromethyl)-3,5,8,8a-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 2-phenyl-6-(trifluoromethyl)-3,5,8,8a-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 91446839 |
| Molecular Formula | C14H13F3N2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-phenyl-6-(trifluoromethyl)-3,5,8,8a-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | FC(F)(F)C1=CCC2N=C(c3ccccc3)CN2C1 |
| InChI | InChI=1S/C14H13F3N2/c15-14(16,17)11-6-7-13-18-12(9-19(13)8-11)10-4-2-1-3-5-10/h1-6,13H,7-9H2 |
| InChIKey | FHOWIASNHYAJIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|