C12H13F3N2 — CID 123589450
3-ethyl-5-[4-(trifluoromethyl)phenyl]-2,4-dihydroimidazole (PubChem CID 123589450) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-ethyl-5-[4-(trifluoromethyl)phenyl]-2,4-dihydroimidazole.
| Compound Name | 3-ethyl-5-[4-(trifluoromethyl)phenyl]-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 123589450 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-ethyl-5-[4-(trifluoromethyl)phenyl]-2,4-dihydroimidazole |
| SMILES | CCN1CN=C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H13F3N2/c1-2-17-7-11(16-8-17)9-3-5-10(6-4-9)12(13,14)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | AWECWFNAQIAAEO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |