C17H19F3N2 — CID 57091089
1-[2-[[2-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]piperidine (PubChem CID 57091089) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-[2-[[2-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]piperidine.
| Compound Name | 1-[2-[[2-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]piperidine |
|---|---|
| PubChem CID | 57091089 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[2-[[2-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]piperidine |
| SMILES | FC(F)(F)c1ccccc1CC1(N2CCCCC2)C=CC=N1 |
| InChI | InChI=1S/C17H19F3N2/c18-17(19,20)15-8-3-2-7-14(15)13-16(9-6-10-21-16)22-11-4-1-5-12-22/h2-3,6-10H,1,4-5,11-13H2 |
| InChIKey | RQBOJKVWSDPWHK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |