C15H18F3N2+ — CID 53328008
2-[[4-(trifluoromethyl)phenyl]methyl]-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium (PubChem CID 53328008) has the molecular formula C15H18F3N2+ and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]methyl]-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]methyl]-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium |
|---|---|
| PubChem CID | 53328008 |
| Molecular Formula | C15H18F3N2+ |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]methyl]-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium |
| SMILES | FC(F)(F)c1ccc(C[N+]2=CC3CCCCN3C2)cc1 |
| InChI | InChI=1S/C15H18F3N2/c16-15(17,18)13-6-4-12(5-7-13)9-19-10-14-3-1-2-8-20(14)11-19/h4-7,10,14H,1-3,8-9,11H2/q+1 |
| InChIKey | ATMACJALDZGWGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|