C22H29F3N2O — CID 67902995
1-[(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 67902995) has the molecular formula C22H29F3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 67902995 |
| Molecular Formula | C22H29F3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[(4aR,8S,8aS)-8-pyrrolidin-1-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)N1CCC[C@H]2CCC[C@H](N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C22H29F3N2O/c23-22(24,25)18-10-8-16(9-11-18)15-20(28)27-14-4-6-17-5-3-7-19(21(17)27)26-12-1-2-13-26/h8-11,17,19,21H,1-7,12-15H2/t17-,19+,21+/m1/s1 |
| InChIKey | MAEHEYMYXTZUMN-LMNJBCLMSA-N |
| XLogP | 4.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |