C20H19F3N2O3 — CID 97318167
2-(4-nitrophenyl)-1-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone (PubChem CID 97318167) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-nitrophenyl)-1-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97318167 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(4-nitrophenyl)-1-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCCC[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)16-8-6-15(7-9-16)18-3-1-2-12-24(18)19(26)13-14-4-10-17(11-5-14)25(27)28/h4-11,18H,1-3,12-13H2/t18-/m1/s1 |
| InChIKey | QQTVOWWHPVBJSR-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|