C20H26F3NO3S — CID 52525260
3-cyclopentylsulfonyl-1-[(2S)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one (PubChem CID 52525260) has the molecular formula C20H26F3NO3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-1-[(2S)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentylsulfonyl-1-[(2S)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 52525260 |
| Molecular Formula | C20H26F3NO3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-cyclopentylsulfonyl-1-[(2S)-2-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)N1CCCC[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H26F3NO3S/c21-20(22,23)16-10-8-15(9-11-16)18-7-3-4-13-24(18)19(25)12-14-28(26,27)17-5-1-2-6-17/h8-11,17-18H,1-7,12-14H2/t18-/m0/s1 |
| InChIKey | ZRKGRURVRSGTNK-SFHVURJKSA-N |
| XLogP | 4.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |