C18H15F6N — CID 11417048
1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-phenylethyl]ethanimine (PubChem CID 11417048) has the molecular formula C18H15F6N and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-phenylethyl]ethanimine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-phenylethyl]ethanimine |
|---|---|
| PubChem CID | 11417048 |
| Molecular Formula | C18H15F6N |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-phenylethyl]ethanimine |
| SMILES | C/C(=N\[C@@H](C)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F6N/c1-11(13-6-4-3-5-7-13)25-12(2)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h3-11H,1-2H3/b25-12+/t11-/m0/s1 |
| InChIKey | HAUDLOVNWUELPH-PCUPTFNLSA-N |
| XLogP | 6.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|