C17H15N3O5S3 — CID 26478169
2-[(3Z)-3-[3-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide (PubChem CID 26478169) has the molecular formula C17H15N3O5S3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[(3Z)-3-[3-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide.
| Compound Name | 2-[(3Z)-3-[3-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 26478169 |
| Molecular Formula | C17H15N3O5S3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 2-[(3Z)-3-[3-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)/C(=C2\SC(=S)N([C@@H]3CCS(=O)(=O)C3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C17H15N3O5S3/c18-12(21)7-19-11-4-2-1-3-10(11)13(15(19)22)14-16(23)20(17(26)27-14)9-5-6-28(24,25)8-9/h1-4,9H,5-8H2,(H2,18,21)/b14-13-/t9-/m1/s1 |
| InChIKey | SSSXRMKPXVSGKV-WMUVVQJISA-N |
| XLogP | 0.28 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|