C22H23N3O7S3 — CID 45126822
2-[[2-[(3Z)-3-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetyl]amino]-3-methylbutanoic acid (PubChem CID 45126822) has the molecular formula C22H23N3O7S3 and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-[[2-[(3Z)-3-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[(3Z)-3-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 45126822 |
| Molecular Formula | C22H23N3O7S3 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 2-[[2-[(3Z)-3-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CN1C(=O)/C(=C2\SC(=S)N(C3CCS(=O)(=O)C3)C2=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H23N3O7S3/c1-11(2)17(21(29)30)23-15(26)9-24-14-6-4-3-5-13(14)16(19(24)27)18-20(28)25(22(33)34-18)12-7-8-35(31,32)10-12/h3-6,11-12,17H,7-10H2,1-2H3,(H,23,26)(H,29,30)/b18-16- |
| InChIKey | OZBOIRPVHRSUAT-VLGSPTGOSA-N |
| XLogP | 1.02 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|