C20H22N2O4S3 — CID 71952362
3-(1,1-dioxothiolan-3-yl)-5-[1-(3-methylbutyl)-2-oxoindol-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71952362) has the molecular formula C20H22N2O4S3 and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[1-(3-methylbutyl)-2-oxoindol-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[1-(3-methylbutyl)-2-oxoindol-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71952362 |
| Molecular Formula | C20H22N2O4S3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[1-(3-methylbutyl)-2-oxoindol-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)CCN1C(=O)C(=C2SC(=S)N(C3CCS(=O)(=O)C3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O4S3/c1-12(2)7-9-21-15-6-4-3-5-14(15)16(18(21)23)17-19(24)22(20(27)28-17)13-8-10-29(25,26)11-13/h3-6,12-13H,7-11H2,1-2H3 |
| InChIKey | LAMMDDVKSBNLQX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|