C21H20N2O4S — CID 2649696
1-benzofuran-2-yl-[2-(2,5-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 2649696) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[2-(2,5-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[2-(2,5-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 2649696 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-benzofuran-2-yl-[2-(2,5-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | COc1ccc(OC)c(/N=C2\SCCCN2C(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C21H20N2O4S/c1-25-15-8-9-18(26-2)16(13-15)22-21-23(10-5-11-28-21)20(24)19-12-14-6-3-4-7-17(14)27-19/h3-4,6-9,12-13H,5,10-11H2,1-2H3/b22-21- |
| InChIKey | BRSNAJWGSPZZOJ-DQRAZIAOSA-N |
| XLogP | 4.72 |
| TPSA | 64.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|