C13H18N2O2S — CID 1432088
N-(2,4-dimethoxyphenyl)-3-methyl-1,3-thiazinan-2-imine (PubChem CID 1432088) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-methyl-1,3-thiazinan-2-imine.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-methyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 1432088 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-methyl-1,3-thiazinan-2-imine |
| SMILES | COc1ccc(/N=C2\SCCCN2C)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O2S/c1-15-7-4-8-18-13(15)14-11-6-5-10(16-2)9-12(11)17-3/h5-6,9H,4,7-8H2,1-3H3/b14-13- |
| InChIKey | NLUFLBKUUIPRHN-YPKPFQOOSA-N |
| XLogP | 2.76 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|