C23H28N2O4S — CID 26516045
4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 26516045) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 26516045 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3cccc4c3CCCC4)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H28N2O4S/c1-16-14-25(15-17(2)29-16)30(27,28)20-12-10-19(11-13-20)23(26)24-22-9-5-7-18-6-3-4-8-21(18)22/h5,7,9-13,16-17H,3-4,6,8,14-15H2,1-2H3,(H,24,26)/t16-,17-/m1/s1 |
| InChIKey | GEZXTIOQBJBJPO-IAGOWNOFSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |