C17H21F3N4O3S — CID 26521141
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 26521141) has the molecular formula C17H21F3N4O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 26521141 |
| Molecular Formula | C17H21F3N4O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cn2ccc(C(F)(F)F)n2)ccc1C |
| InChI | InChI=1S/C17H21F3N4O3S/c1-4-24(5-2)28(26,27)14-10-13(7-6-12(14)3)21-16(25)11-23-9-8-15(22-23)17(18,19)20/h6-10H,4-5,11H2,1-3H3,(H,21,25) |
| InChIKey | YNTXQUQBALUODB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |