C15H21N3O6 — CID 26526409
methyl 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate (PubChem CID 26526409) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 26526409 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | methyl 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate |
| SMILES | CCNC(=O)NC(=O)CNc1cc(OC)c(OC)cc1C(=O)OC |
| InChI | InChI=1S/C15H21N3O6/c1-5-16-15(21)18-13(19)8-17-10-7-12(23-3)11(22-2)6-9(10)14(20)24-4/h6-7,17H,5,8H2,1-4H3,(H2,16,18,19,21) |
| InChIKey | VYUFSTFUTKYFTG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|