C15H20N4O4S — CID 26531386
N-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 26531386) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 26531386 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | CN(C)c1ccc(CNS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C15H20N4O4S/c1-17(2)12-7-5-11(6-8-12)9-16-24(22,23)13-10-18(3)15(21)19(4)14(13)20/h5-8,10,16H,9H2,1-4H3 |
| InChIKey | AQEBYBINIOEOMQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|