C16H21N3O4S — CID 26531792
1,3-dimethyl-2,4-dioxo-N-[(2R)-2-phenylbutyl]pyrimidine-5-sulfonamide (PubChem CID 26531792) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-[(2R)-2-phenylbutyl]pyrimidine-5-sulfonamide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-[(2R)-2-phenylbutyl]pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 26531792 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-[(2R)-2-phenylbutyl]pyrimidine-5-sulfonamide |
| SMILES | CC[C@@H](CNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O4S/c1-4-12(13-8-6-5-7-9-13)10-17-24(22,23)14-11-18(2)16(21)19(3)15(14)20/h5-9,11-12,17H,4,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | QTLMDMIFGVFAEK-LBPRGKRZSA-N |
| XLogP | 0.56 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |