C25H31N3O6 — CID 26565706
N-[4-[(2S)-butan-2-yl]phenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)imidazolidin-1-yl]acetamide (PubChem CID 26565706) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)imidazolidin-1-yl]acetamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 26565706 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-(3,4,5-trimethoxyphenyl)imidazolidin-1-yl]acetamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)CN2C(=O)N[C@](C)(c3cc(OC)c(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H31N3O6/c1-7-15(2)16-8-10-18(11-9-16)26-21(29)14-28-23(30)25(3,27-24(28)31)17-12-19(32-4)22(34-6)20(13-17)33-5/h8-13,15H,7,14H2,1-6H3,(H,26,29)(H,27,31)/t15-,25+/m0/s1 |
| InChIKey | ZTWUOGDKPSMQFR-ODCWNRFASA-N |
| XLogP | 3.63 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|