C24H30N2O5S — CID 2659545
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2659545) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2659545 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)c1C |
| InChI | InChI=1S/C24H30N2O5S/c1-5-11-26-18(3)14-21(19(26)4)22(27)16-31-24(28)20-10-9-17(2)23(15-20)32(29,30)25-12-7-6-8-13-25/h5,9-10,14-15H,1,6-8,11-13,16H2,2-4H3 |
| InChIKey | AWNLFOYSUPLERX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|