C17H12BrNO4S2 — CID 26597882
phenyl 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-thiazole-5-carboxylate (PubChem CID 26597882) has the molecular formula C17H12BrNO4S2 and a molecular weight of 438.32 g/mol. Its IUPAC name is phenyl 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-thiazole-5-carboxylate.
| Compound Name | phenyl 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 26597882 |
| Molecular Formula | C17H12BrNO4S2 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 436.94 |
| IUPAC Name | phenyl 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(Br)c(C(=O)Oc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C17H12BrNO4S2/c1-11-7-9-13(10-8-11)25(21,22)17-19-15(18)14(24-17)16(20)23-12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | DMLXNLISPLZBMJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|