About 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate
2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate (PubChem CID 2662475) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate |
| PubChem CID | 2662475 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate |
| SMILES | COc1ccc(CCOC(=O)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-13(20)19-16-5-3-4-15(12-16)18(21)23-11-10-14-6-8-17(22-2)9-7-14/h3-9,12H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | RYESEHFLEMPPSJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate?
The IUPAC name of 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate (CID 2662475) is 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate.
What is the SMILES notation for 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate?
The canonical SMILES for 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate is COc1ccc(CCOC(=O)c2cccc(NC(C)=O)c2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate?
The InChIKey is RYESEHFLEMPPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-13(20)19-16-5-3-4-15(12-16)18(21)23-11-10-14-6-8-17(22-2)9-7-14/h3-9,12H,10-11H2,1-2H3,(H,19,20).
What are the key properties of 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate?
2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate has a molecular weight of 313.35 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)ethyl 3-acetamidobenzoate is sourced from PubChem (CID 2662475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).