C20H18ClNO7 — CID 26683660
dimethyl 5-[3-[(4-chlorobenzoyl)amino]propanoyloxy]benzene-1,3-dicarboxylate (PubChem CID 26683660) has the molecular formula C20H18ClNO7 and a molecular weight of 419.82 g/mol. Its IUPAC name is dimethyl 5-[3-[(4-chlorobenzoyl)amino]propanoyloxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[(4-chlorobenzoyl)amino]propanoyloxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26683660 |
| Molecular Formula | C20H18ClNO7 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | dimethyl 5-[3-[(4-chlorobenzoyl)amino]propanoyloxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)CCNC(=O)c2ccc(Cl)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H18ClNO7/c1-27-19(25)13-9-14(20(26)28-2)11-16(10-13)29-17(23)7-8-22-18(24)12-3-5-15(21)6-4-12/h3-6,9-11H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | NJOLLVQLAKRPST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|